Abstract:The title compound Fe(CH4N2S)(2)Cl(2)(.)2(C11H6N2O) (M-r = 643.35) has been prepared and its crystal structure was determined by X-ray diffraction method with the following data: triclinic, space group P $(1) over bar $, a = 7.3742(10), b = 13.0427(12), c = 15.215(2) Angstrom, alpha = 88.969(12), beta = 79.004(12), gamma = 79.689(11)degrees, V = 1408.1(3) Angstrom(3), Z = 2, D-x = 1.517 g/cm(3), mu = 0.912 mm(-1) and F(000) = 656. The final R = 0.030 and wR = 0.078 for 4070 observed reflections (I > 2sigma(I)), and R = 0.064 and wR = 0.091 for 5516 independent ones. The crystal consists of tetrahedral Fe(H) complex and hydrogen bonded 4,5-diazafluoren-9-one (dafone). The carbonyl bridge in dafone distorts the bipyridine moiety and results in the longer (NN)-N-... separation of 3.071(3) and 3.061(3) Angstrom. There exists an extensive intermolecular hydrogen bond network in the crystal, and pi-pi stacking is observed between the neighboring dafone rings.

4,5-Bis(Furoylsulfanyl)-1,3-Dithiole-2-Thione

2-Methylsulfanyl-5,6-dihydro-2h-1,3-dithiolo[4,5-b][1,4] Dioxin-2-Ium Tetrafluoroborate

4-(Pyridin-2-yl)-1,3-dithiol-2-one.

Synthesis and Crystal Structure of Bis- （thiourea）dichloroiron（ii） Di（4,5-diazafluoren-9-one）

2,2′-Diamino-4,4′-bi-1,3-thiazolium Fumarate

Dichlorobis(Thiourea)Cobalt(Ii) Di(4,5-Diazafluoren-9-One)

Bis(3-hydroxypyridinium) Fumarate

(E)-Dimethyl 4-(Ethylamino)-5-styrylfuran-2,3-dicarboxylate

5,5′-Dimethyl-2,2′-dithiodi-1,3,4-thiadiazole

Dimethyl 2-(4-Fluorophenyl)-3-(methylamino)-furan-4,5-dicarboxylate

(E)-Dimethyl 4-butylamino-5-(4-methylstyryl)-furan-2,3-dicarboxylate

Methyl 7-Chloro-2-ethylsulfanyl-6-fluoro-4-oxo-4h-thiochromene-3-carboxylate

Ethyl 4-methyl-1,3-dioxo-1,2,3,4-tetrahydroisoquinoline-4-carboxylate

4&#946;-Hydroxy-12,13-epoxytrichothec-9-ene

1,3′,7,7-Tetramethylspiro[bicyclo[2.2.1]heptane-2,2′-thiolane] 1′,1′-Dioxide

Synthesis and crystal structure of 4,5-(cis-cyclohexylenedithio)-1,3-dithiole-2-one

(1R,4s,8r,9r,12s,13s,14r,16s,17r,19r)-17-[(ethylsulfanyl)methyl]-9,14-dihydroxy-7,7-dimethyl-2,18-dioxo-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadecan-19-yl Acetate Acetone Solvate

(1R,2r,4s,5s)-1,2,4,8,8-pentamethyl-3-thiabicyclo[3.2.1]octane 3,3-Dioxide

Bis[4-Phenyl-5-(1h-1,2,4-Triazol-3-Yl)-4h-1,2,4-Triazol-3-Yl] Disulfide

9-Isopropenyl-4-methyl-2h-thieno[2,3-h]chromen-2-one

2-Ethyl-sulfanyl-7-fluoro-3-(1h-1,2,4-triazol-1-yl)-4h-thio-chromen-4-one.