Crystal Structure of Triaqua-( 2,2'-Bipyridine)-( 5-Nitroisophthaiato) - Nickel(ii) Monohydrate, Ni(H2O)3(C10H8N2)(C8H3NO6)* H2O

Ning Zhao,Zhaoxun Lian,Y.L. Deng,Yang Gu,Xiaobo Li,Jiamin Zhang
DOI: https://doi.org/10.1524/ncrs.2009.224.14.333
2009-01-01
Zeitschrift für Kristallographie - New Crystal Structures
Abstract:C18H19N3NÍO10, triclinic, P\ (no.2), a = 7.467(1) Â, b = 10.804(2)Â, c = 12.796(2) Â, a = 90.021(2)°,β = 92.580(2)°,γ = 105.526(2)°,V= 993.5 Â 3 , Z= 2, Rgt(F) = 0.040, wRteffF 2 ) = 0.115,7= 298 K.
What problem does this paper attempt to address?