Two Polymeric Complexes of Norfloxacin with Iron(II) and Their Magnetic Properties
ZR Qu,Z Hong,LX Xing,XS Wang,ZF Chen,Z Yu,RG Xiong,XZ You
DOI: https://doi.org/10.1002/ejic.200300242
IF: 2.551
2003-01-01
European Journal of Inorganic Chemistry
Abstract:The reaction of H-Norf with (NH4)(2)Fe(SO4)(2).6H(2)O and Fe(OH)(3) (or Fe2O3) affords Fe(H-Norf)(2)(SO4).2H(2)O (1) and Fe(Norf)(2).4H(2)O (2), respectively, both of which have 2D polymeric structures. Their interesting magnetic properties are also reported. Crystal data for 1: monoclinic, P2(1)/c, a = 23.166(l), b = 10.0492(4), c = 7.7264(3) Angstrom, beta = 98.379(1)degrees, V = 1779.50(13) Angstrom(3), Z = 2; for 2: monoclinic, P2(1)/c, a = 5.8411(12), b = 21.685(4), c = 13.265(3) Angstrom, beta = 99.20(3)degrees, V = 1658.6(6) Angstrom(3), Z = 2. (C) Wiley-VCH Verlag GmbH & Co. KGaA, 69451 Weinheim, Germany, 2003.