Synthesis and Characterization of Iron, Cobalt, and Nickel Complexes Bearing Novel N,N‐Chelate Ligands and Their Catalytic Properties in Ethylene Oligomerization

Li Wang,Cheng Zhang,Zhong-Xia Wang
DOI: https://doi.org/10.1002/ejic.200700020
IF: 2.551
2007-01-01
European Journal of Inorganic Chemistry
Abstract:Treatment of o-ROC6H4NC (R = PhCH2, iPr) with [Li{2CH(SiMe3)C5H4N}] afforded dimeric lithium complexes [Li{N(o-ROC6H4)C(SiMe3)CH(2-C5H4N)}](2) (3, R = PhCH2; 4, R = iPr). Reaction of the lithium complexes with 1 equiv. of (dme)NiCl2 gave nickel complexes [Ni{N(o-ROC6H4)C(SiMe3)CH(2-C5H4N)}(2)] (5, R = PhCH2; 6, R = iPr). The stoichiometric reaction of complexes 3 and 4 with Et3NH+Cl- formed 2-{o-ROC6H4NHC(SiMe3)CH}C5H4N (7, R = PhCH2; 8, R = iPr) in quantitative yields. Reaction of 7 or 8 with metal halides, including (dme)NiCl2, NiBr2, FeCl2 center dot 4H(2)O, and CoCl2 yielded complexes [MX2{(o-ROC6H4)N=C(SiMe3)CH2(2-C5H4N)}] (9, R = PhCH2, M Ni, X Cl; 10, R = iPr, M = Ni, X = Cl; 11, R = PhCH2, M Ni, X Br; 12, R = NY, M = Ni, X = Br; 13, R = PhCH2, M Fe, X Cl; 14, R = iPr, M = Fe, X = Cl; 15, R = PhCH2, M = Co, X = Cl; 16, R = iPr, M = Co, X = Cl). For comparasion, nickel and cobalt complexes [MX2{(o-MeC6H4)N=C(SiMe3)CH2(2-C5H4N)}] (M = Ni, X = Br, 18; M = Co, X = Cl, 19) were similarly synthesized through reaction of 2-{o-MeC6H4NHC(SiMe3)CH}C5H4N (17) with NiBr2 and CoCl2, respectively. These compounds were characterized by NMR (for 3, 4, 7, 8, and 17) and IR (for 5-19) spectroscopy, elemental analyses and HRMS (for 5, 6, and 9-19). The molecular structures of complexes 3, 6, 12, and 14 were characterized by single-crystal X-ray diffraction techniques. The catalytic behavior in ethylene oligomerization of complexes 5, 6, 9-16, 18, and 19 was investigated. Under optimal conditions, the complexes showed good catalytic activities upon activation with appropriate aluminum co-catalysts (8.72 X 10(2) to 18.2X10(2) kg/molh atm for the nickel complexes upon activation with Et2AlCl and 4.3 X 10(2) to 8.1 X 10(2) kg/molhatm for the iron and cobalt complexes upon activation with MMAC).
What problem does this paper attempt to address?