4,4′-Bipyridylium bis(hydrogen 2,2′-dithiodibenzoate) dihydrate
Rui Feng Hu,Yi Hang Wen,Jian Zhang,Zhao Ji Li,Yuan Gen Yao
DOI: https://doi.org/10.1107/S1600536804025565
2004-01-01
Abstract:The title compound, C10H10N22+.2C(14)H(9)O(4)S(2)(-).2H(2)O, was obtained by the reaction of Zn(NO3)(2) with 2,2'-dithiodibenzoic acid and 4,4'-bipyridine in ethanol. The compound consists of hydrogen 2,2'-dithiodibenzoate anions, centrosymmetric 4,4'-bipyridylium cations and water molecules. Hydrogen-bonding interactions between the components lead to the formation a three-dimensional network.