Abstract:The structure of compound I: poly-diaqua(μ-imidazole-4,5-dicarboxylato-N,O; -O′; -O′′, -O′′′) calcium(II) monohydrate [Ca(C5H2N2O4)(H2O)2·H2O] is built of molecular sheets in which imidazole-4,5-dicarboxylate ligands bridge the metal ions using both carboxylate groups, each bidentate. Ca(II) is coordinated by six oxygen atoms and one hetero-ring nitrogen atom distributed at the apices of a capped tetragonal bipyramid. The basal plane of the pyramid is formed by two carboxylate oxygen atoms [d(Ca–O2 = 2.374(1) Å, d(Ca–O4) = 2.412(1) Å] and two water oxygen atoms [d(Ca–O5) = 2.384(1) Å, d(Ca–O6) = 2.455(1) Å], the capped position is occupied by the carboxylate oxygen atom O3 [d(Ca–O3) = 2.325(1) Å], the hetero-ring nitrogen atom [d(Ca–N2) = 2.523(1) Å] and the carboxylate oxygen atom O4 [d(Ca–O2) = 2.412(1) Å] form the apices of the prism. The solvation water molecule plays a significant role in a framework of hydrogen bonds responsible for the stability of the crystal. The structure of compound II: trans-tetraquadi(H-imidazole-4,5-dicarboxylato-N,O) calcium(II) monohydrate, [Ca(C5H3N2O4)2(H2O)4·H2O] consists of monomers in which the Ca(II) ion is located on a centre of symmetry. The coordination around the Ca(II) is a strongly deformed pentagonal bipyramidal with the imidazole-4,5-dicarboxylate (4,5-IDA) ligands in the trans arrangement forming a dihedral angle of 68.3°. An imidazole-ring nitrogen atom [d(Ca–N) = 2.632(2) Å] and one carboxylate O atom [d(Ca–O) = 2.531(2) Å] from each ligand coordinate to the metal ion. The coordination is completed by four water oxygen atoms [d(Ca–O) = 2.393(2) Å] and [d(Ca–O) = 2.367(2) Å]. The coordinated water molecules act as hydrogen bond donors and acceptors to the unbonded carboxylate oxygen atoms in adjacent monomers giving rise to a three-dimensional molecular network.

Molecular sheets in the crystal structure of a Ba(II) complex with imidazole-4,5-dicarboxylate and water ligands

Synthesis and Crystal Structure of Aquabis(imidazole)bis[4-Methylbenzoato(1-)]manganese(ii)

Crystal structures of two Ca(II) complexes with imidazole-4,5-dicarboxylate and water ligands

SYNTHESIS AND CRYSTAL STRUCTURE OF A POLYMERIC 1,2,4,5-BENZENETETRACARBOXYLATO COMPLEX OF Cu(II) WITH IMIDAZOLE, Cu2(C10H2O8)(C3H4N2)6(H2O)4 · 4H2O

Bis(μ-iminodiacetato)bis[(2,2′-diamino-4,4′-bi-1,3-thiazole)lead(II)] Tetrahydrate

Polymeric Aqua(benzimidazole-?N)(-malonato)cobalt(ii)

Bis(2,2′-diamino-4,4′-bi-1,3-thiazole-N,N′)(dichloro)cobalt(II) Dihydrate

A new three-dimensional barium(II) coordination polymer constructed from N,N'-bis(glycinyl)pyromellitic diimide: microwave-assisted synthesis, structure, Hirshfeld surface analysis and properties

Bis(&#956;-iminodiacetato)bis[(2,2&#8242;-diamino-4,4&#8242;-bi-1,3-thiazole)lead(II)] tetrahydrate

Synthesis and Crystal Structure of Aqua(diaminobithiazole) (iminodiacetato)nickel(ii) Hydrate

Poly[Octa-Mu-Aqua-Tetraaquabis(Mu-5-Sulfonatobenzene-1,3-Dicarboxylato)C Obalt(Ii)Tetrasodium]

Bis(1H-imidazole-&#954;N3)bis(2-oxidopyridinium-3-carboxylato-&#954;2O2,O3)cobalt(II)

The Crystal Structure of a Strontium(II) Complex with Pyrazine-2,6-Dicarboxylate and Water Ligands

Synthesis and crystal structure of a new two-dimensional coordination polymer, {[Co-II(imbz)(2)]center dot H2O}(n) [imbz(-)=4 '-(imidazol-1-ylmethyl)benzoate anion]

Aqua(2,2 '-Diamino-4,4 '-Bi-1,3-thiazole-kappa N-2,N ')(Oxydiacetato-Kappa O-3,O ',O '')zinc(ii) Dihydrate

1,2,4-Diazaphospholide Complexes of Barium: Mechanism of Formation and Crystallographic Characterization

Synthesis and Crystal Structure of a New Two-Dimensional Coordination Polymer, {[coii(imbz)2]·h2o}n [imbz− = 4′-(Imidazol-1-ylmethyl)benzoate Anion]

Synthesis and crystal structure of a new two-dimensional coordination polymer, {[CoII(imbz)2]·H2O}n [imbz- = 4′-(imidazol-1-ylmethyl)benzoate anion]

Diaquabis(5-carboxy-1H-imidazole-4carboxylato-kappa N-2,O)zinc(II)-4,4 '-bipyridine (1/1)

Synthesis And Crystal Structure Of Bis(Barbiturato)Triwater Complex Of Copper(Ii)

Synthesis and Structures of A Series of D(10) Coordination Compounds Based on Flexible Bis(Imidazole) Ligand and Dicarboxylates