Synthesis and Crystal Structure of Bis- （thiourea）dichloroiron（ii） Di（4,5-diazafluoren-9-one）
ZY Wu,DJ Xu,JY Wu,MY Chang
DOI: https://doi.org/10.3969/j.issn.0254-5861.2004.11.005
2004-01-01
Abstract:The title compound Fe(CH4N2S)(2)Cl(2)(.)2(C11H6N2O) (M-r = 643.35) has been prepared and its crystal structure was determined by X-ray diffraction method with the following data: triclinic, space group P $(1) over bar $, a = 7.3742(10), b = 13.0427(12), c = 15.215(2) Angstrom, alpha = 88.969(12), beta = 79.004(12), gamma = 79.689(11)degrees, V = 1408.1(3) Angstrom(3), Z = 2, D-x = 1.517 g/cm(3), mu = 0.912 mm(-1) and F(000) = 656. The final R = 0.030 and wR = 0.078 for 4070 observed reflections (I > 2sigma(I)), and R = 0.064 and wR = 0.091 for 5516 independent ones. The crystal consists of tetrahedral Fe(H) complex and hydrogen bonded 4,5-diazafluoren-9-one (dafone). The carbonyl bridge in dafone distorts the bipyridine moiety and results in the longer (NN)-N-... separation of 3.071(3) and 3.061(3) Angstrom. There exists an extensive intermolecular hydrogen bond network in the crystal, and pi-pi stacking is observed between the neighboring dafone rings.