Syntheses And Crystalline Structures Of Co-3(Co)(7)(Mu(3)-S) [Mu, Eta(2)-C*N*P(S)(C6h4och3)Oc(Ph)Ch] (I) And Co-3(Co)(7)(Mu(3)-S) [Mu, Eta(2)-S*Cn*C(Ch3)(2)P(S)(Cl)N(Ph)] (Ii)

L Guan,St Liu,Bf Wu,Sy Yu
2002-01-01
Chinese journal of inorganic chemistry
Abstract:Through the reaction of Co-2(CO)(8) with two heterocyclic ligands of C(S)NHP(S)(C6H4OCH3)OC(Ph)CH(L-1) and C(S)NHC(CH)P(S) (Cl)N(Ph) (L-2), the two trinuclear cobalt carbonyl sulfur clusters, Co-3(CO)(7)(mu(3)-S) [mu, eta(2)-(CNP)-N-.-P-.(S) (C6H4OCH3) OC(Ph) CH] ( I) and Co-3(CO)(7)(mu(3)-S) [mu, eta(2)-(SCNC)-C-.-C-.(CH) P(S) (Cl) N(Ph)] ( II), were prepared and characterized by IR, H-1 NMR, P-31 NMR, MS spectroscopy and X-ray crystal diffraction. The crystals of I and II are triclinic, belonging to space group P1, a = 0.84768 (1) nm, b = 1. 19043 (3) rim, c = 1.43639(1) nm, alpha = 86.926(1)degrees, beta = 81.603(3)degrees, gamma = 88.535(2), V = 1.4318(5) nm(3), Z = 2, D-c = 1.641g (.) cm(-3), F(000) = 716, mu = 1.893mm(-1), R = 0.0602, R-w = 0.1515 for complex I; a = 1.2050(2) nm, b = 1.2448 (2) nm, c = 0.8951(2) nm, alpha = 97.49(1)degrees, beta = 93.552(4), gamma = 108.432(3), V = 1.2554(3) nm3, Z = 2, D-c = 1.841g (.) cm(-3), F(000) = 690, mu = 2.419mm(-1), R = 0.0423, R-w = 0.1075 for complex II. The structure analyses show that the Co3S frameworks of I and II are a triangular pyramid, respectively, and for which the sulfur atom as face bridging ligand and all carbonyls as terminal ligand link up with three cobalts in the cluster framework. I contains a four-member ring of CoCoCN and II has a five-member of CoCoSCN.
What problem does this paper attempt to address?