Selective synthesis of fullerenol derivatives with terminal alkyne and crown ether addends.

Huan Huang,Gang Zhang,Sisi Liang,Nana Xin,Liangbing Gan
DOI: https://doi.org/10.1021/jo300118h
2012-01-01
Abstract:A series of isomerically pure alkynyl-substituted fullerenol derivatives such as C-60(OH)(6)(O(CH2)(3)CCH)(2) were synthesized through Lewis acid catalyzed epoxy ring opening and/or S(N)1 replacement reactions starting from the fullerene-mixed peroxide C-60(O)(t-BuOO)(4). Copper-catalyzed azide-alkyne cycloaddition readily converted the terminal alkynyl groups into triazole groups. Intramolecular oxidative alkyne coupling afforded a fullerenyl crown ether derivative.
What problem does this paper attempt to address?