Crystal Structure of Dicesium Aquapentachlorochromate(iii), Cs2[CrCl5(H2O)]

JX Mi,X Zhou,H Zhang,SY Mato,JT Zhao

DOI: https://doi.org/10.1524/ncrs.2004.219.14.105

2004-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:Cl5CrCs2H2O, orthorhombic, Cmcm (no. 63), a = 7.4297(6) Å, b = 17.234(1) Å, c = 8.0121(6) Å, V = 1025.9 Å3, Z = 4, Rgt(F) = 0.041, wRref(F2) = 0.082, T = 295 K.

What problem does this paper attempt to address?

Aqua(2,2'-diamino-4,4'-bi-1,3-thiazole-kappa2N,N')(iminodiacetato-kappa3O,N,O')chromium(III) chloride monohydrate.

Bing Xin Liu,Duan Jun Xu

2004-01-01

Abstract:Crystals of the title compound, [Cr(C4H5NO4)(C6H6N4S2)(H2O)]Cl.H2O, consist of Cr(III) complex cations, Cl- counter-ions and lattice water molecules. The complex cation assumes an octahedral coordination geometry, formed by a tridentate iminodiacetate dianion (IDA), a diaminobithiazole (DABT) molecule and a water molecule. The planar DABT group chelates the Cr(III) ion with normal Cr-N distances [2.0574 (17) and 2.0598 (17) A], but the DABT molecule is inclined to the coordination plane by a dihedral angle of 17.23 (7) degrees. In the monodentate carboxylate groups of the IDA ion, the coordinated C-O bonds [1.288 (3) and 1.284 (3) A] are much longer than the uncoordinated C-O bonds [1.222 (3) and 1.225 (3) A].
Aqua(2,2 '-Diamino-4,4 '-Bi-1,3-thiazole-kappa N-2,N ')(Iminodiacetato-Kappa O-3,N,O ')chromium(iii) Chloride Monohydrate

BX Liu,DJ Xu

DOI: https://doi.org/10.1107/s0108270104002288

2004-01-01

Abstract:Crystals of the title compound, [Cr(C4H5NO4)(C6H6N4S2)-(H2O)]Cl.H2O, consist of Cr-III complex cations, Cl- counter-ions and lattice water molecules. The complex cation assumes an octahedral coordination geometry, formed by a tridentate iminodiacetate dianion (IDA), a diaminobithiazole (DABT) molecule and a water molecule. The planar DABT group chelates the Cr-III ion with normal Cr-N distances [2.0574 (17) and 2.0598 (17) Angstrom], but the DABT molecule is inclined to the coordination plane by a dihedral angle of 17.23 (7)degrees. In the monodentate carboxylate groups of the IDA ion, the coordinated C-O bonds [1.288 (3) and 1.284 (3) Angstrom] are much longer than the uncoordinated C-O bonds [1.222 (3) and 1.225 (3) Angstrom].
The Crystal Structure of (E)-3-chloro-2-(2-(2-fluorobenzylidene)hydrazinyl)pyridine, C12H9ClFN3

Hui-Zhen Wu,Li-Jing Min,Liang Han,Xing-Hai Liu,Na-Bo Sun

DOI: https://doi.org/10.1515/ncrs-2021-0164

2021-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C12H9ClFN3, monoclinic, C2/c (no. 15), a = 24.713(13) Å, b = 15.459(13) Å, c = 17.507(12) Å, β = 17.515(11)°, V = 4742(6) Å3, Z = 16, Rgt(F) = 0.0530, wRref(F2) = 0.1161, T = 113(2) K.
Crystal Structure of 3-(Tert-butyldiphenylsilyl)-1-(2,6-dichlorophenyl)-2,2-diphenylpropan-1-ol, C37H36Cl2OSi

Shu-Liang Zhang,Zhao-Zhao Zhou,Xi Chen

DOI: https://doi.org/10.1515/ncrs-2023-0450

2024-01-01

Abstract:C37H36Cl2OSi, monoclinic P21/n (no. 14), a = 10.4363(14) Å, b = 17.128(2) Å, c = 17.875(3) Å, β = 90.934(2)°, V = 3194.8(8) Å3, Z = 4, Rgt(F) = 0.0491, wRref(F2) = 0.1449, T = 296.15 K.
Crystal Structure of Diethylenetriaminesilver(I) Perchlorate, Ag(C4h13n3)(Clo4)

HL Zhu,SC Shao,JL Ma,XY Qiu,S Yang,L Sun

DOI: https://doi.org/10.1524/ncrs.2003.218.4.499

2003-01-01

Abstract:Abstract C4H13AgClN3O4, orthorhombic, Pccn (No. 56), a = 17.730(7) Å, b = 7.162(3) Å, c = 15.891(7) Å, V = 2017.9 Å3, Z = 8, Rgt(F) = 0.047, wRref(F2) = 0.152, T = 298 K.
Crystal Structure of (1-Cyclopropyl-6-fluoro-7-chloro-1,4-dihydro- 4-Oxo-3-quinolinecarboxylato)chloro(2,2′-bipyridine)copper(ii) Dihydrate, CuCL(C10H8N2)(C13H8NClFo3) · 2H2O

LM Xie,GP Wang,HY He,LG Zhu

DOI: https://doi.org/10.1524/ncrs.2003.218.jg.257

2003-01-01

Abstract:Abstract C23H20Cl2CuFN3O5, triclinic, P1 (No. 2), a = 10.329(2) Å, b = 11.417(4) Å, c = 10.225(3) Å, α = 95.77(3)°, β = 99.10(2)°, γ = 98.65(2)°, V= 1167.5 Å3, Z= 2, Rgt(F) = 0.050, wRobs(F) = 0.061, T = 293 K.
Crystal Structure of Μ2-Hydroxyl-bis(5-methyl-1,4,9-triazanonanezinc(ii)) Triperchlorate, C14H39Cl3N6O13Zn2

HL Zhu,FJ Meng,ZD Wang,F Yang

DOI: https://doi.org/10.1524/ncrs.2003.218.jg.343

2003-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C14H39Cl3N6O13Zn2, monoclinic, P12(1)/m1 (No. 11), a = 7.802(2) Angstrom, b = 12.121(3) Angstrom, c = 15.662(3) Angstrom, beta = 104.29(2)degrees, V= 1435.3 Angstrom(3), Z = 2, R-gt(F) = 0.055, wR(ref)(F-2) = 0.152, T= 293 K.
The Crystal Structure of 1,6-Di-tert-butyl-1,1,3,3,4,4,6,6-octamethyl-2,2,5,5-tetrakis (trimethylsilyl)hexasilane, C28H78Si10

Xu-Qiong Xiao,Jun-Ting Xu,Yinan Wu,Qiong-Yan Wang

DOI: https://doi.org/10.1515/ncrs-2019-0321

2019-01-01

Abstract:Abstract C28H78Si10, monoclinic, Pn (no. 7), a = 21.413(4) Å, b = 9.8568(17) Å, c = 22.074(4) Å, β = 93.426(4)°, V = 4650.6(14) Å3, Z = 4, R gt(F) = 0.0613, wR ref(F 2) = 0.1750, T = 296(2) K.
Crystal Structure of 3,3,4,4,5,5-Hexafluoro-{1-[2-methyl-5- (4-Formylphenyl)-thien-3-yl]-2-[2-methyl-5-(4-(1,3-dioxolan- 2-Yl)phenyl)-thien-3-yl]}-cyclopent-1-ene, C31H22F6O3S2

SZ Pu,Q Xiao,RJ Wang,JK Xu,L Shen,B Chen

DOI: https://doi.org/10.1524/ncrs.2005.220.14.265

2005-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C31H22F6O3S2, monoclinic, P12(1)/c1 (no. 14), a = 27.16(1) angstrom, b = 9.334(2) angstrom, c = 10.929(3) angstrom, beta = 92.10(3)degrees, V = 2768.4 angstrom(3), Z = 4, R-gt(F) = 0.128, wR(ref)(F-2) = 0. 199, T = 293 K.
Crystal Structure of Poly[tetraaqua-Bis(μ4-5-(4-carboxy-benzylamino)-isophthalato-κ4o,o′:O′′:o′′′)-(μ2-4,4′-di(1h-imidazol-1-yl)-1,1′-biphenyl-κ2n:n′)dicadmium(ii)], C25H22N3O8Cd

Shihui Li,Guanfeng Li,Li Zhang

DOI: https://doi.org/10.1515/ncrs-2020-0228

2020-01-01

Abstract:Abstract C25H22N3O8Cd, triclinic, P1̄ (no. 2), a = 10.2722(10) Å, b = 10.6897(11) Å, c = 12.5667(13) Å, α = 79.698(9)°, β = 72.168(9)°, γ = 63.166(10)°, V = 1170.8(2) Å3, Z = 2, Rgt(F) = 0.0618, wRref(F2) = 0.1078, T = 293(2) K.
Crystal Structure of Dichloro-Bis[N-(4-Cyanophenyl)Salicylaldiminato]-Dizinc(Ii), Zn2cl2(C14h9n2o)(2)

JF Xie,J Qiao,Y Qiu

DOI: https://doi.org/10.1524/ncrs.2005.220.14.231

2005-01-01

Abstract:C28H18Cl2N4O2Zn2, monoclinic, P12(1/c)1 (no. 14), a = 11.550(2) angstrom, b = 13.987(2) angstrom, c = 8.580(2) angstrom, beta = 110.36(1)degrees, V= 1299.5 angstrom(3), Z = 2, R-gt(F) = 0.035, wR(ref) (F-2) = 0. 115, T = 293 K.
The crystal structure of hexaquazinc poly dizinc]

Tai Xi-Shi,Yan Xi-Hai,Wang Yuan-Fang,Wang Li-Hua

DOI: https://doi.org/10.1515/ncrs-2024-0042

2024-06-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C 42 H 54 O 18 S 6 Zn 3 , trigonal, P 3 ̅ 1 m (no. 162), a = 9.2916(13) Å, c = 18.121(4) Å, V = 1354.9(5) Å 3 , Z = 0.99996, R gt ( F ) = 0.0490, w R ref ( F 2 ) = 0.1330, T = 293(2) K.

crystallography
Crystal Structure of Tetrakis(Acetonitrile)Zinc(Ii) Sulfate, Zn(C2h3n)(4)So4

HL Yang,F Yang,HL Zhu

DOI: https://doi.org/10.1524/ncrs.2004.219.14.349

2004-01-01

Abstract:C8H12N4O4SZn, orthorhombic, Pna2(1) (no. 33), a = 24.25(1) Angstrom, b = 8.456(3) Angstrom, c = 20.743(8) Angstrom, V = 4253.9 Angstrom(3), Z = 12, R-gt(F) = 0.050, wR(ref)(F-2) = 0.131, T = 298 K.
Crystal structure of dichlorido-bis(1-[(2-ethyl-benzimidazole-1-yl)methyl]-1 H –benzotriazole) cadmium(II), C 32 H 32 CdN 10 OCl 2

Jing Yang,Tan-Peng Zhou,Meng-Meng Cao,Xia Wang

DOI: https://doi.org/10.1515/ncrs-2024-0167

2024-06-19

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C 32 H 32 CdN 10 OCl 2 , monoclinic, C2/c (no. 15), a = 28.820(3) Å, b = 13.1075(2) Å, c = 16.7266(19) Å, β = 149.29(3)°, Z = 4, V = 3226.9(15) Å 3 , R gt (F) = 0.0341, wR ref (F 2 ) = 0.0893, T = 293(2) K.

crystallography
Crystal Structure of 3,3,4,4,5,5-Hexafluoro-1,2-bis(5-(3-trifluorophenyl)-2-methyl-3-thienyl) -Cyclopent-1-ene,c29h16f12s2

SZ Pu,RJ Wang,L Shen,G Liu,JK Xu,Q Xiao,B Chen

DOI: https://doi.org/10.1524/ncrs.2005.220.14.81

2005-01-01

Abstract:C29H16F12S2, monoclinic, C12/cl (no. 15), a = 20.687(3) angstrom, b = 8.3928(9) angstrom, c = 16.568(2) angstrom, beta = 104.39(1)degrees, V = 2786.3 angstrom(3), Z = 4, R-gt(F) = 0.082, wR(ref)(F-2) = 0.164, T = 293 K.
Crystal Structure of (1,10-Phenanthroline-κ2n,n')-dimethyl-formamidepentaaqua-thulium(iii) Trichloride Monohydrate, [tm(c12h8n2)((ch3)2ncho)(h2o)5]cl3·h2o, C15H27Cl3N3O7Tm

Yong-Sheng Yang,Min Liu,Xin Wang,Jian-Bao Li,Qiong-Hua Jin

DOI: https://doi.org/10.1524/ncrs.2013.0175

2013-01-01

Abstract:Abstract C15H27Cl3N3O7Tm, monoclinic, P21/c (no. 14), a = 17.492(2) Å, b = 9.6752(5) Å, c = 14.972(1) Å, β = 110.986(2)°, V = 2365.8 Å3, Z = 4, Rgt(F) = 0.0409, wRref(F2) = 0.1023, T = 298 K.
Crystal Structure of Ethyl 2-(2-(2-(4-chlorophenyl)-3-methylbutanamido)thiazol-4-yl)acetate, C18h21cln2o3s

Zong-Cheng Wang,Jin-Hao Zhao,Jing-Li Cheng,Hong-Yu Jiang,Xiao-Wen Liu

DOI: https://doi.org/10.1515/ncrs-2014-9011

2016-01-01

Abstract:C18H21ClN2O3S, monoclinic, P21/c, a = 12.582(4) Å, b = 14.790(5) Å, c = 21.406(8) Å, β = 92.572(13)°, V = 3979(2) Å3, Z = 8, Rgt(F) = 0.0464, wRref(F2) = 0.1298, T = 298(2) K.
Crystal Structure of Bis(3,5-Dichloro-n-2-(dimethylamino)ethylsalicylaldiminato- Κ3n,n',o)manganese(ii) Monohydrate, Mn(C11H13Cl2N2O)2 · H2O

Limei Wang,Xifeng Zhang,Wanyong Zeng,Zhiguo Liu,Lieju Liu

DOI: https://doi.org/10.1524/ncrs.2012.0119

2012-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C22H28Cl4MnN4O3, orthorhombic, Pbcn (no. 60), a = 12.376(2) angstrom, b = 9.249(1) angstrom, c = 22.827(3) angstrom, V = 2612.9 angstrom(3), Z = 4, R-gt(F) = 0.036, wR(ref)(F-2) = 0.112, T = 291 K.
Crystal Structure of Poly-[Aqua-μ 2-Aqua-μ 2-(4,4′-oxybis(benzoato)-κ 4 O,O′:O′′,O′′′)cadmium(II)], C14H12O7Cd

Bao Guang-Ming,Xiao Wei,Sun Ting-Ting,Hu Chun-Yan,Wang Yi-Hua,Yuan Hou-Qun

DOI: https://doi.org/10.1515/ncrs-2016-0084

2016-01-01

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C14H12O7Cd, orthorhombic, Ima2 (no. 46), a = 30.715(3) Å, b = 7.8833(8) Å, c = 5.8202(6) Å, V = 1409.3(2) Å3, Z = 4, Rgt(F) = 0.0159, wRref(F2) = 0.0400, T = 296(2) K.
The crystal structure of dichlorido-bis(3-methyl-3-imidazolium-1-ylpropionato-κ 2 O , O ′)-zinc(II), C 14 H 20 Cl 2 N 4 O 4 Zn

Xinsheng Wang,Xiuge Wang

DOI: https://doi.org/10.1515/ncrs-2024-0051

2024-03-28

Zeitschrift für Kristallographie - New Crystal Structures

Abstract:C 14 H 20 Cl 2 N 4 O 4 Zn, monoclinic, P 2 1 / n (no. 14), a = 8.562(2) Å, b = 27.953(8) Å, c = 8.804(2) Å, β = 117.092(4)°, V = 1875.9(9) Å 3 , Z = 4, R gt ( F ) = 0.0441, w R ref ( F 2 ) = 0.1031, T = 296 K.

crystallography

Crystal Structure of Dicesium Aquapentachlorochromate(iii), Cs2[CrCl5(H2O)]

Aqua(2,2'-diamino-4,4'-bi-1,3-thiazole-kappa2N,N')(iminodiacetato-kappa3O,N,O')chromium(III) chloride monohydrate.

Aqua(2,2 '-Diamino-4,4 '-Bi-1,3-thiazole-kappa N-2,N ')(Iminodiacetato-Kappa O-3,N,O ')chromium(iii) Chloride Monohydrate

The Crystal Structure of (E)-3-chloro-2-(2-(2-fluorobenzylidene)hydrazinyl)pyridine, C12H9ClFN3

Crystal Structure of 3-(Tert-butyldiphenylsilyl)-1-(2,6-dichlorophenyl)-2,2-diphenylpropan-1-ol, C37H36Cl2OSi

Crystal Structure of Diethylenetriaminesilver(I) Perchlorate, Ag(C4h13n3)(Clo4)

Crystal Structure of (1-Cyclopropyl-6-fluoro-7-chloro-1,4-dihydro- 4-Oxo-3-quinolinecarboxylato)chloro(2,2′-bipyridine)copper(ii) Dihydrate, CuCL(C10H8N2)(C13H8NClFo3) · 2H2O

Crystal Structure of Μ2-Hydroxyl-bis(5-methyl-1,4,9-triazanonanezinc(ii)) Triperchlorate, C14H39Cl3N6O13Zn2

The Crystal Structure of 1,6-Di-tert-butyl-1,1,3,3,4,4,6,6-octamethyl-2,2,5,5-tetrakis (trimethylsilyl)hexasilane, C28H78Si10

Crystal Structure of 3,3,4,4,5,5-Hexafluoro-{1-[2-methyl-5- (4-Formylphenyl)-thien-3-yl]-2-[2-methyl-5-(4-(1,3-dioxolan- 2-Yl)phenyl)-thien-3-yl]}-cyclopent-1-ene, C31H22F6O3S2

Crystal Structure of Poly[tetraaqua-Bis(μ4-5-(4-carboxy-benzylamino)-isophthalato-κ4o,o′:O′′:o′′′)-(μ2-4,4′-di(1h-imidazol-1-yl)-1,1′-biphenyl-κ2n:n′)dicadmium(ii)], C25H22N3O8Cd

Crystal Structure of Dichloro-Bis[N-(4-Cyanophenyl)Salicylaldiminato]-Dizinc(Ii), Zn2cl2(C14h9n2o)(2)

The crystal structure of hexaquazinc poly dizinc]

Crystal Structure of Tetrakis(Acetonitrile)Zinc(Ii) Sulfate, Zn(C2h3n)(4)So4

Crystal structure of dichlorido-bis(1-[(2-ethyl-benzimidazole-1-yl)methyl]-1 H –benzotriazole) cadmium(II), C 32 H 32 CdN 10 OCl 2

Crystal Structure of 3,3,4,4,5,5-Hexafluoro-1,2-bis(5-(3-trifluorophenyl)-2-methyl-3-thienyl) -Cyclopent-1-ene,c29h16f12s2

Crystal Structure of (1,10-Phenanthroline-κ2n,n')-dimethyl-formamidepentaaqua-thulium(iii) Trichloride Monohydrate, [tm(c12h8n2)((ch3)2ncho)(h2o)5]cl3·h2o, C15H27Cl3N3O7Tm

Crystal Structure of Ethyl 2-(2-(2-(4-chlorophenyl)-3-methylbutanamido)thiazol-4-yl)acetate, C18h21cln2o3s

Crystal Structure of Bis(3,5-Dichloro-n-2-(dimethylamino)ethylsalicylaldiminato- Κ3n,n',o)manganese(ii) Monohydrate, Mn(C11H13Cl2N2O)2 · H2O

Crystal Structure of Poly-[Aqua-μ 2-Aqua-μ 2-(4,4′-oxybis(benzoato)-κ 4 O,O′:O′′,O′′′)cadmium(II)], C14H12O7Cd

The crystal structure of dichlorido-bis(3-methyl-3-imidazolium-1-ylpropionato-κ 2 O , O ′)-zinc(II), C 14 H 20 Cl 2 N 4 O 4 Zn