Synthesis and Characteristics of 2-D Inorganic-Organic Hybrid Layered Net Framework Crystals

S Xin,QR Fang,W Gang,TI Ge,GS Zhu,Y Ling,CL Wang,ZD Zhang,SL Qiu
DOI: https://doi.org/10.3321/j.issn:0567-7351.2003.06.011
2003-01-01
Abstract:Two 2-D inorganic-organic hybrid layered network materials Zn(BDC) (C3H3N2) . (DMF) (1) and Co-2-(BDC)(2)(C5H5N)(4).2(DMF)(C5H5N)(2) were synthesized under mild synthesis condition. Their crystal structures were determined. by using single crystal X-ray diffraction. Crystal structures were solved by direct method and refined by full-matrix least-square method. Compound 1 is monoclinic, space group C2/c with a = 2.1059(4) nm, b = 1.0316(2) nm, c = 1.4836(3) nm, beta = 99.09(3)degrees, V = 3.1826(11) nm(3), Z = 4, D-X = 1.543 Mg/m(3), C14H14N3O5Zn, M-r = 369.65, mu = 1.571 mm(-1), F (000) = 1512, R = 0.0697, R-w = 0.2018, and compound 2 is monoclinic, space group P2(1)/n with a = 1.0829 (2) nm, b = 1.5431 (3) nm, c = 1.4428 (3) nm, beta = 101.65 (3)degrees, V = 2.3612 (8) nm(3), Z = 2, D-X = 1.391 Mg/m(3), C47H47N7O10Co2, M-r = 987.78, mu = 0.767 mm(-1), F(000) = 1024, R = 0.0652, R-w = 0.1888. They are layered networks with 0.9 nm x 0.9 nm pore.
What problem does this paper attempt to address?