Assembly of a New Cyano‐bridged 4f‐3d Dimer Sm(DMSO)4‐ (h2o)3cr(cn)6 and Crystal Structure of [K3(18‐crown‐6)3‐(h2o)4]cr(cn)6·3h2o

BC Zhou,HZ Kou,Y He,RJ Wang,YD Li,HG Wang
DOI: https://doi.org/10.1002/cjoc.20030210326
2003-01-01
Abstract:A new cyano-bridged binuclear 4f-3d complex Sm(DMSO)(4)(H2O)(3)Cr(CN)(6) Was synthesized and characterized by single crystal structure analysis. It crystallizes in monodinic, space group P2(1) with a = 0.9367(2) nin, b = 1. 3917(3) nm, c = 1.1212 (2) nm P = 99.88(3)degrees and Z = 2. In this binuclear complex, Sin atom is eight coordinated and linked to the Or atom by a cyano bridge. The molecules packs to form 31) structure due to the hydrogen bonds among them. [K-3(18-C-6)(3)(H2O)(4)] Cr(CN)(6) . 3H(2)O (18-C-6 represents 18-crown-6-ether) that was synthesized as a byproduct in the preparation of a Gd-Cr complex is also structurally characterized. Crystal data: triclinic, space group P-1 with a = 1.0496(7) nm, b = 1.1567 (14) nm, c = 1.3530 (13) nm, alpha = 94.15 (9)degrees, beta = 96.04(8)degrees, gamma = 95.25(9)degrees and Z = 1. [K-3(18-C-6)(3)(H2O)(4)]Cr(CN)(6) . 3H(2)O consists of ionic [ K-3 (18-C-6)(3) (H(2)o)(4)](3+) and [Cr(CN)(6)](3-) pain, of which the [k(3)(18-C-6)(3)(H2O)(4)](3+) ion is a trinuclear duster connected by water, and K atoms are eight coordinated by eight oxygen atoms of one 18-C-6 and two water molecules.
What problem does this paper attempt to address?