A new strategy for the synthesis of polytrithiocarbonates using a polymeric support system

Yezi You,Chunyan Hong,Caiyuan Pan
DOI: https://doi.org/10.1002/1521-3927(20020901)23:13<776::AID-MARC776>3.0.CO;2-X
IF: 5.006
2002-01-01
Macromolecular Rapid Communications
Abstract:A new polymerization strategy, consisting of nucleophilic substitution reaction between CS32-, immobilized on a polymeric support, and dimethyl a,a'-dibromoalkylanedioate in solution, leads to the formation of polytrithiocarbonates. When n = 0, 1 in CH3OOC-CHBr(CH2)nCHBrCOOCH(3) (a,a'-dibromoalkylanedioate), only five- or six-membered cyclic trithiocarbonates were obtained; n greater than or equal to 2 resulted in the formation of polytrithiocarbonates.
What problem does this paper attempt to address?