Synthesis and Characterization of Neutral Iron(Ii) and Ruthenium(Ii) Complexes with the Isocyanotriphenylborate Ligand

Yan Zhou,Hong-Ping Xiao,Ling-Chen Kang,Jing-Lin Zuo,Cheng-Hui Li,Xiao-Zeng You
DOI: https://doi.org/10.1039/b914262b
IF: 4
2009-01-01
Dalton Transactions
Abstract:By reacting metal cyanide complexes with NaBPh(4) in the presence of acid at room temperature, a new class of neutral isocyanotriphenylborate-containing complexes trans-Ru(L)(4)(CNBPh(3))(2) (L = pyridine, 1; 4-methylpyridine, 2; 4-tert-butylpyridine, 3), cis-Ru(bipy)(2)(CNBPh(3))(2) (4, bipy = 2,2'-bipyridine) and cis-M(phen)(2)(CNBPh(3))(2) (M = Ru, 5; M = Fe, 6; phen = 1,10-phenanthroline) have been synthesized. These new complexes are characterized by IR, UV spectroscopy and single-crystal X-ray diffractions. The electron withdrawing triphenylborate group on the isocyanide ligands has a pronounced effect on the photophysical properties of complexes 1-6 in comparison with other ruthenium(II) and iron(II) isocyanide complexes. The excitation energies corresponding to metal-to-ligand charge transfer (MLCT) shift to higher energies while the (3)MLCT emissions are quenched at room temperature.
What problem does this paper attempt to address?