4-(4-Chlorophenyl)-3,7,7-trimethyl-1-[2-(4-nitrobenzoyl)ethyl]-4,7,8,9-tetrahydro-1H-pyrazolo[3,4-b]quinolin-5(6H)-one-ethanol (1/1).

J. N. Low,J. Cobo,M. Nogueras,A. Sánchez,J. Quiroga,D. Mejía
DOI: https://doi.org/10.1107/S0108270101014913
2001-11-15
Abstract:Molecules of the title compound, C(28)H(27)ClN(4)O(4).C(2)H(6)O, form a C(6) chain via an N--H...O hydrogen bond along the c axis by the operation of a c-glide plane, with N...O = 2.761 (3) A and N--H...O = 165 degrees. The molecules are further linked by a weak C--H...O interaction, with C.O = 3.344 (4) A and C--H...O = 150 degrees. Pendant hydrogen-bonded ethanol solvent molecules are attached to the chains by O--H...N hydrogen bonds, with O...N = 2.904 (3) A and O--H...N = 175 degrees.
What problem does this paper attempt to address?